C12H17BrN2O3 — CID 114781472
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-methyl-1,2-oxazol-4-yl)methanone (PubChem CID 114781472) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-methyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-methyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 114781472 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-methyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1oncc1C(=O)N1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C12H17BrN2O3/c1-8-10(5-14-18-8)11(16)15-6-9(4-13)17-12(2,3)7-15/h5,9H,4,6-7H2,1-3H3 |
| InChIKey | NDPXHKBJRJFIFI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|