About [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 103122961) has the molecular formula C12H18BrN3O2
and a molecular weight of 316.20 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone |
| PubChem CID | 103122961 |
| Molecular Formula | C12H18BrN3O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cn1ccc(C(=O)N2CC(CBr)OC(C)(C)C2)n1 |
| InChI | InChI=1S/C12H18BrN3O2/c1-12(2)8-16(7-9(6-13)18-12)11(17)10-4-5-15(3)14-10/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | DEQXBSCOIWLWFT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone?
The IUPAC name of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone (CID 103122961) is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone.
What is the SMILES notation for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone?
The canonical SMILES for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone is Cn1ccc(C(=O)N2CC(CBr)OC(C)(C)C2)n1.
What is the InChIKey of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone?
The InChIKey is DEQXBSCOIWLWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrN3O2/c1-12(2)8-16(7-9(6-13)18-12)11(17)10-4-5-15(3)14-10/h4-5,9H,6-8H2,1-3H3.
What are the key properties of [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone?
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone has a molecular weight of 316.20 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(1-methylpyrazol-3-yl)methanone is sourced from PubChem (CID 103122961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).