C14H17BrINO2 — CID 114781585
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3-iodophenyl)methanone (PubChem CID 114781585) has the molecular formula C14H17BrINO2 and a molecular weight of 438.10 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3-iodophenyl)methanone.
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 114781585 |
| Molecular Formula | C14H17BrINO2 |
| Molecular Weight | 438.10 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(3-iodophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cccc(I)c2)CC(CBr)O1 |
| InChI | InChI=1S/C14H17BrINO2/c1-14(2)9-17(8-12(7-15)19-14)13(18)10-4-3-5-11(16)6-10/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | FIZFCRSRACCTHS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.10 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|