C15H19BrClNO3 — CID 114781526
[6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone (PubChem CID 114781526) has the molecular formula C15H19BrClNO3 and a molecular weight of 376.68 g/mol. Its IUPAC name is [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone.
| Compound Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 114781526 |
| Molecular Formula | C15H19BrClNO3 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | [6-(bromomethyl)-2,2-dimethylmorpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C15H19BrClNO3/c1-15(2)9-18(8-11(7-16)21-15)14(19)12-6-10(17)4-5-13(12)20-3/h4-6,11H,7-9H2,1-3H3 |
| InChIKey | GJMZAETYHTVEQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|