C14H16Cl2FNO2 — CID 114781270
(5-chloro-2-fluorophenyl)-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]methanone (PubChem CID 114781270) has the molecular formula C14H16Cl2FNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 114781270 |
| Molecular Formula | C14H16Cl2FNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]methanone |
| SMILES | CC1(C)CN(C(=O)c2cc(Cl)ccc2F)CC(CCl)O1 |
| InChI | InChI=1S/C14H16Cl2FNO2/c1-14(2)8-18(7-10(6-15)20-14)13(19)11-5-9(16)3-4-12(11)17/h3-5,10H,6-8H2,1-2H3 |
| InChIKey | DMOZGPNUUJJBGU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|