C14H26ClNO2 — CID 114781375
1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]heptan-1-one (PubChem CID 114781375) has the molecular formula C14H26ClNO2 and a molecular weight of 275.82 g/mol. Its IUPAC name is 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]heptan-1-one.
| Compound Name | 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]heptan-1-one |
|---|---|
| PubChem CID | 114781375 |
| Molecular Formula | C14H26ClNO2 |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C14H26ClNO2/c1-4-5-6-7-8-13(17)16-10-12(9-15)18-14(2,3)11-16/h12H,4-11H2,1-3H3 |
| InChIKey | RHTXLGAONSOMGJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|