C15H19Cl2NO3 — CID 114781317
1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 114781317) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 114781317 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-[6-(chloromethyl)-2,2-dimethylmorpholin-4-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | CC1(C)CN(C(=O)COc2ccc(Cl)cc2)CC(CCl)O1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-15(2)10-18(8-13(7-16)21-15)14(19)9-20-12-5-3-11(17)4-6-12/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | NNPIZRURDZDNKE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|