C12H22BrNO4S — CID 114781881
6-(bromomethyl)-2,2-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine (PubChem CID 114781881) has the molecular formula C12H22BrNO4S and a molecular weight of 356.28 g/mol. Its IUPAC name is 6-(bromomethyl)-2,2-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine.
| Compound Name | 6-(bromomethyl)-2,2-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine |
|---|---|
| PubChem CID | 114781881 |
| Molecular Formula | C12H22BrNO4S |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 6-(bromomethyl)-2,2-dimethyl-4-(oxolan-2-ylmethylsulfonyl)morpholine |
| SMILES | CC1(C)CN(S(=O)(=O)CC2CCCO2)CC(CBr)O1 |
| InChI | InChI=1S/C12H22BrNO4S/c1-12(2)9-14(7-11(6-13)18-12)19(15,16)8-10-4-3-5-17-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | XSOKYNBZIQRZAV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|