C13H24ClNO2 — CID 103140049
6-(chloromethyl)-2,2-dimethyl-4-[(5-methyloxolan-2-yl)methyl]morpholine (PubChem CID 103140049) has the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-[(5-methyloxolan-2-yl)methyl]morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-[(5-methyloxolan-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 103140049 |
| Molecular Formula | C13H24ClNO2 |
| Molecular Weight | 261.79 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-[(5-methyloxolan-2-yl)methyl]morpholine |
| SMILES | CC1CCC(CN2CC(CCl)OC(C)(C)C2)O1 |
| InChI | InChI=1S/C13H24ClNO2/c1-10-4-5-11(16-10)7-15-8-12(6-14)17-13(2,3)9-15/h10-12H,4-9H2,1-3H3 |
| InChIKey | PQMAPYVJKBULJA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|