C10H19NO3 — CID 103137660
(3R,4S)-1-[(5-methyloxolan-2-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 103137660) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (3R,4S)-1-[(5-methyloxolan-2-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[(5-methyloxolan-2-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 103137660 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (3R,4S)-1-[(5-methyloxolan-2-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | CC1CCC(CN2C[C@@H](O)[C@@H](O)C2)O1 |
| InChI | InChI=1S/C10H19NO3/c1-7-2-3-8(14-7)4-11-5-9(12)10(13)6-11/h7-10,12-13H,2-6H2,1H3/t7?,8?,9-,10+ |
| InChIKey | LUAWETDWOPBPNE-OXYCZDQYSA-N |
| XLogP | -0.41 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |