C13H21NO5 — CID 103136020
1-[(5-methyloxolan-2-yl)methyl]piperidine-3,4-dicarboxylic acid (PubChem CID 103136020) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-[(5-methyloxolan-2-yl)methyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[(5-methyloxolan-2-yl)methyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 103136020 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[(5-methyloxolan-2-yl)methyl]piperidine-3,4-dicarboxylic acid |
| SMILES | CC1CCC(CN2CCC(C(=O)O)C(C(=O)O)C2)O1 |
| InChI | InChI=1S/C13H21NO5/c1-8-2-3-9(19-8)6-14-5-4-10(12(15)16)11(7-14)13(17)18/h8-11H,2-7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | RJIJMNFAOUARBV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |