C9H14N2O — CID 145143851
1-[[(2S,5S)-5-methyloxolan-2-yl]methyl]pyrazole (PubChem CID 145143851) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-[[(2S,5S)-5-methyloxolan-2-yl]methyl]pyrazole.
| Compound Name | 1-[[(2S,5S)-5-methyloxolan-2-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 145143851 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1-[[(2S,5S)-5-methyloxolan-2-yl]methyl]pyrazole |
| SMILES | C[C@H]1CC[C@@H](Cn2cccn2)O1 |
| InChI | InChI=1S/C9H14N2O/c1-8-3-4-9(12-8)7-11-6-2-5-10-11/h2,5-6,8-9H,3-4,7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | BSNODJFCRXHYFF-IUCAKERBSA-N |
| XLogP | 1.45 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |