C11H19N3O — CID 172900914
2,6-dimethyl-4-(2-pyrazol-1-ylethyl)morpholine (PubChem CID 172900914) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-pyrazol-1-ylethyl)morpholine.
| Compound Name | 2,6-dimethyl-4-(2-pyrazol-1-ylethyl)morpholine |
|---|---|
| PubChem CID | 172900914 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2,6-dimethyl-4-(2-pyrazol-1-ylethyl)morpholine |
| SMILES | CC1CN(CCn2cccn2)CC(C)O1 |
| InChI | InChI=1S/C11H19N3O/c1-10-8-13(9-11(2)15-10)6-7-14-5-3-4-12-14/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | HLMUOEWURKNMOR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |