About N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide
N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide (PubChem CID 15067958) has the molecular formula C21H30N4O
and a molecular weight of 354.50 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide.
Molecular Properties
| Compound Name | N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
| PubChem CID | 15067958 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1C(C)CN(CCn2cccn2)CC1C |
| InChI | InChI=1S/C21H30N4O/c1-4-20(26)25(19-9-6-5-7-10-19)21-17(2)15-23(16-18(21)3)13-14-24-12-8-11-22-24/h5-12,17-18,21H,4,13-16H2,1-3H3 |
| InChIKey | GPOAQNUHDDWPJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide?
The IUPAC name of N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide (CID 15067958) is N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide.
What is the SMILES notation for N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide?
The canonical SMILES for N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide is CCC(=O)N(c1ccccc1)C1C(C)CN(CCn2cccn2)CC1C.
What is the InChIKey of N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide?
The InChIKey is GPOAQNUHDDWPJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O/c1-4-20(26)25(19-9-6-5-7-10-19)21-17(2)15-23(16-18(21)3)13-14-24-12-8-11-22-24/h5-12,17-18,21H,4,13-16H2,1-3H3.
What are the key properties of N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide?
N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide has a molecular weight of 354.50 g/mol, XLogP of 3.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dimethyl-1-(2-pyrazol-1-ylethyl)piperidin-4-yl]-N-phenylpropanamide is sourced from PubChem (CID 15067958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).