C20H28N4O — CID 97226849
N-[(3S,5S)-1-benzyl-3,5-dimethylpiperidin-4-yl]-3-pyrazol-1-ylpropanamide (PubChem CID 97226849) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[(3S,5S)-1-benzyl-3,5-dimethylpiperidin-4-yl]-3-pyrazol-1-ylpropanamide.
| Compound Name | N-[(3S,5S)-1-benzyl-3,5-dimethylpiperidin-4-yl]-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 97226849 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-[(3S,5S)-1-benzyl-3,5-dimethylpiperidin-4-yl]-3-pyrazol-1-ylpropanamide |
| SMILES | C[C@H]1CN(Cc2ccccc2)C[C@H](C)C1NC(=O)CCn1cccn1 |
| InChI | InChI=1S/C20H28N4O/c1-16-13-23(15-18-7-4-3-5-8-18)14-17(2)20(16)22-19(25)9-12-24-11-6-10-21-24/h3-8,10-11,16-17,20H,9,12-15H2,1-2H3,(H,22,25)/t16-,17-/m0/s1 |
| InChIKey | DZUBRLWFDFBSKE-IRXDYDNUSA-N |
| XLogP | 2.55 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |