C18H25F3N2O — CID 97092752
N-[(3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-4,4,4-trifluorobutanamide (PubChem CID 97092752) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[(3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[(3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 97092752 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(3R,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-4,4,4-trifluorobutanamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@@H](C)C1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O/c1-13-10-23(12-15-6-4-3-5-7-15)11-14(2)17(13)22-16(24)8-9-18(19,20)21/h3-7,13-14,17H,8-12H2,1-2H3,(H,22,24)/t13-,14-/m1/s1 |
| InChIKey | MBMUSJSHTBPAGU-ZIAGYGMSSA-N |
| XLogP | 3.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |