C17H23F3N2O — CID 124758221
N-[2-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-4,4,4-trifluorobutanamide (PubChem CID 124758221) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[2-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[2-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 124758221 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[2-[(3R)-1-benzylpyrrolidin-3-yl]ethyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NCC[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H23F3N2O/c18-17(19,20)9-6-16(23)21-10-7-15-8-11-22(13-15)12-14-4-2-1-3-5-14/h1-5,15H,6-13H2,(H,21,23)/t15-/m1/s1 |
| InChIKey | YBANBQKKZOUSBT-OAHLLOKOSA-N |
| XLogP | 3.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |