C14H19F3N2 — CID 55025121
1-benzyl-N-(3,3,3-trifluoropropyl)pyrrolidin-3-amine (PubChem CID 55025121) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-benzyl-N-(3,3,3-trifluoropropyl)pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-(3,3,3-trifluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 55025121 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-benzyl-N-(3,3,3-trifluoropropyl)pyrrolidin-3-amine |
| SMILES | FC(F)(F)CCNC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H19F3N2/c15-14(16,17)7-8-18-13-6-9-19(11-13)10-12-4-2-1-3-5-12/h1-5,13,18H,6-11H2 |
| InChIKey | HOARJRDCXFXHRQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |