C14H23N3 — CID 54251680
N'-[(3S)-1-benzylpyrrolidin-3-yl]propane-1,3-diamine (PubChem CID 54251680) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N'-[(3S)-1-benzylpyrrolidin-3-yl]propane-1,3-diamine.
| Compound Name | N'-[(3S)-1-benzylpyrrolidin-3-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 54251680 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N'-[(3S)-1-benzylpyrrolidin-3-yl]propane-1,3-diamine |
| SMILES | NCCCN[C@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H23N3/c15-8-4-9-16-14-7-10-17(12-14)11-13-5-2-1-3-6-13/h1-3,5-6,14,16H,4,7-12,15H2/t14-/m0/s1 |
| InChIKey | QXFCVRMJDNCRHR-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|