C18H25N3O2S — CID 124780262
(4S)-N-[(3S,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 124780262) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is (4S)-N-[(3S,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4S)-N-[(3S,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 124780262 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (4S)-N-[(3S,5R)-1-benzyl-3,5-dimethylpiperidin-4-yl]-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@H](C)C1NC(=O)[C@H]1CSC(=O)N1 |
| InChI | InChI=1S/C18H25N3O2S/c1-12-8-21(10-14-6-4-3-5-7-14)9-13(2)16(12)20-17(22)15-11-24-18(23)19-15/h3-7,12-13,15-16H,8-11H2,1-2H3,(H,19,23)(H,20,22)/t12-,13+,15-,16?/m1/s1 |
| InChIKey | KLYJEBBDXWNSOP-XFDYKOMQSA-N |
| XLogP | 2.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|