C8H12N2O2 — CID 130668729
1-(1,3-dioxan-4-ylmethyl)pyrazole (PubChem CID 130668729) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-(1,3-dioxan-4-ylmethyl)pyrazole.
| Compound Name | 1-(1,3-dioxan-4-ylmethyl)pyrazole |
|---|---|
| PubChem CID | 130668729 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-(1,3-dioxan-4-ylmethyl)pyrazole |
| SMILES | c1cnn(CC2CCOCO2)c1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-9-10(4-1)6-8-2-5-11-7-12-8/h1,3-4,8H,2,5-7H2 |
| InChIKey | GOYANGLOQCDTME-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |