C15H29ClN2O — CID 114015270
6-(chloromethyl)-2,2-dimethyl-4-[2-(1-methylpiperidin-2-yl)ethyl]morpholine (PubChem CID 114015270) has the molecular formula C15H29ClN2O and a molecular weight of 288.86 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-[2-(1-methylpiperidin-2-yl)ethyl]morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-[2-(1-methylpiperidin-2-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 114015270 |
| Molecular Formula | C15H29ClN2O |
| Molecular Weight | 288.86 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-[2-(1-methylpiperidin-2-yl)ethyl]morpholine |
| SMILES | CN1CCCCC1CCN1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C15H29ClN2O/c1-15(2)12-18(11-14(10-16)19-15)9-7-13-6-4-5-8-17(13)3/h13-14H,4-12H2,1-3H3 |
| InChIKey | ZGGFEKWGTJQTNY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.86 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|