C13H26ClNO2 — CID 114780607
6-(chloromethyl)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethyl]morpholine (PubChem CID 114780607) has the molecular formula C13H26ClNO2 and a molecular weight of 263.81 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethyl]morpholine.
| Compound Name | 6-(chloromethyl)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethyl]morpholine |
|---|---|
| PubChem CID | 114780607 |
| Molecular Formula | C13H26ClNO2 |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyl-4-[2-[(2-methylpropan-2-yl)oxy]ethyl]morpholine |
| SMILES | CC(C)(C)OCCN1CC(CCl)OC(C)(C)C1 |
| InChI | InChI=1S/C13H26ClNO2/c1-12(2,3)16-7-6-15-9-11(8-14)17-13(4,5)10-15/h11H,6-10H2,1-5H3 |
| InChIKey | IEAJYSLXVMZJDF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|