C13H26BrNO3 — CID 103184081
6-(bromomethyl)-4-[2-(3-methoxypropoxy)ethyl]-2,2-dimethylmorpholine (PubChem CID 103184081) has the molecular formula C13H26BrNO3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 6-(bromomethyl)-4-[2-(3-methoxypropoxy)ethyl]-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-[2-(3-methoxypropoxy)ethyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 103184081 |
| Molecular Formula | C13H26BrNO3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 6-(bromomethyl)-4-[2-(3-methoxypropoxy)ethyl]-2,2-dimethylmorpholine |
| SMILES | COCCCOCCN1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C13H26BrNO3/c1-13(2)11-15(10-12(9-14)18-13)5-8-17-7-4-6-16-3/h12H,4-11H2,1-3H3 |
| InChIKey | RUBFGQXFRRCKDH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|