C10H21NO4 — CID 103182797
(3S,4R)-1-[2-(3-methoxypropoxy)ethyl]pyrrolidine-3,4-diol (PubChem CID 103182797) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is (3S,4R)-1-[2-(3-methoxypropoxy)ethyl]pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-[2-(3-methoxypropoxy)ethyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 103182797 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (3S,4R)-1-[2-(3-methoxypropoxy)ethyl]pyrrolidine-3,4-diol |
| SMILES | COCCCOCCN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H21NO4/c1-14-4-2-5-15-6-3-11-7-9(12)10(13)8-11/h9-10,12-13H,2-8H2,1H3/t9-,10+ |
| InChIKey | OPKCXKSSIHYKSP-AOOOYVTPSA-N |
| XLogP | -0.92 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|