C9H19NO3 — CID 106671973
1-(2-propoxyethyl)pyrrolidine-3,4-diol (PubChem CID 106671973) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-(2-propoxyethyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-propoxyethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106671973 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 1-(2-propoxyethyl)pyrrolidine-3,4-diol |
| SMILES | CCCOCCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C9H19NO3/c1-2-4-13-5-3-10-6-8(11)9(12)7-10/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | QGSXDTQIOFRMEY-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|