C20H41NO2 — CID 129411144
(3S,4S)-1-hexadecylpyrrolidine-3,4-diol (PubChem CID 129411144) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is (3S,4S)-1-hexadecylpyrrolidine-3,4-diol.
| Compound Name | (3S,4S)-1-hexadecylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 129411144 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | (3S,4S)-1-hexadecylpyrrolidine-3,4-diol |
| SMILES | CCCCCCCCCCCCCCCCN1C[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-17-19(22)20(23)18-21/h19-20,22-23H,2-18H2,1H3/t19-,20-/m0/s1 |
| InChIKey | WPCDGAGJIYCFHC-PMACEKPBSA-N |
| XLogP | 4.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|