C13H26N2O3 — CID 90002769
N-(1-hexyl-4,5-dihydroxypiperidin-3-yl)acetamide (PubChem CID 90002769) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is N-(1-hexyl-4,5-dihydroxypiperidin-3-yl)acetamide.
| Compound Name | N-(1-hexyl-4,5-dihydroxypiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 90002769 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-(1-hexyl-4,5-dihydroxypiperidin-3-yl)acetamide |
| SMILES | CCCCCCN1CC(O)C(O)C(NC(C)=O)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-3-4-5-6-7-15-8-11(14-10(2)16)13(18)12(17)9-15/h11-13,17-18H,3-9H2,1-2H3,(H,14,16) |
| InChIKey | DKNPNBMKGGMCMM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|