C11H18N4O3 — CID 106454766
1-[1-(2-propoxyethyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 106454766) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-[1-(2-propoxyethyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-propoxyethyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106454766 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-[1-(2-propoxyethyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CCCOCCN1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C11H18N4O3/c1-2-4-18-5-3-14-6-9(7-14)15-8-10(11(16)17)12-13-15/h8-9H,2-7H2,1H3,(H,16,17) |
| InChIKey | UTPGDPOHYHEAFM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|