C11H18N4O4S — CID 79311135
1-[1-(3-ethylsulfonylpropyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79311135) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is 1-[1-(3-ethylsulfonylpropyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(3-ethylsulfonylpropyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79311135 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[1-(3-ethylsulfonylpropyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CCS(=O)(=O)CCCN1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C11H18N4O4S/c1-2-20(18,19)5-3-4-14-6-9(7-14)15-8-10(11(16)17)12-13-15/h8-9H,2-7H2,1H3,(H,16,17) |
| InChIKey | CLYBJEUKZZUYTI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |