C7H11N5O4S — CID 114806601
1-[1-(methylsulfamoyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 114806601) has the molecular formula C7H11N5O4S and a molecular weight of 261.26 g/mol. Its IUPAC name is 1-[1-(methylsulfamoyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(methylsulfamoyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114806601 |
| Molecular Formula | C7H11N5O4S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-[1-(methylsulfamoyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CNS(=O)(=O)N1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C7H11N5O4S/c1-8-17(15,16)11-2-5(3-11)12-4-6(7(13)14)9-10-12/h4-5,8H,2-3H2,1H3,(H,13,14) |
| InChIKey | IMGAJSJLBANVCG-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |