C10H13N5O5 — CID 79310941
1-[1-[2-(methoxycarbonylamino)-2-oxoethyl]azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79310941) has the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 1-[1-[2-(methoxycarbonylamino)-2-oxoethyl]azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-[2-(methoxycarbonylamino)-2-oxoethyl]azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79310941 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-[1-[2-(methoxycarbonylamino)-2-oxoethyl]azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | COC(=O)NC(=O)CN1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C10H13N5O5/c1-20-10(19)11-8(16)5-14-2-6(3-14)15-4-7(9(17)18)12-13-15/h4,6H,2-3,5H2,1H3,(H,17,18)(H,11,16,19) |
| InChIKey | VBKFYZPNISFFBP-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |