C15H21Br2NO2 — CID 114780794
6-(bromomethyl)-4-[2-(4-bromophenoxy)ethyl]-2,2-dimethylmorpholine (PubChem CID 114780794) has the molecular formula C15H21Br2NO2 and a molecular weight of 407.15 g/mol. Its IUPAC name is 6-(bromomethyl)-4-[2-(4-bromophenoxy)ethyl]-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-[2-(4-bromophenoxy)ethyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114780794 |
| Molecular Formula | C15H21Br2NO2 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 6-(bromomethyl)-4-[2-(4-bromophenoxy)ethyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(CCOc2ccc(Br)cc2)CC(CBr)O1 |
| InChI | InChI=1S/C15H21Br2NO2/c1-15(2)11-18(10-14(9-16)20-15)7-8-19-13-5-3-12(17)4-6-13/h3-6,14H,7-11H2,1-2H3 |
| InChIKey | JOOBMMMCYONMOI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|