C13H27N3O2S — CID 120779565
1-(azepan-1-ylsulfonyl)-3,3-dimethylpiperidin-4-amine (PubChem CID 120779565) has the molecular formula C13H27N3O2S and a molecular weight of 289.45 g/mol. Its IUPAC name is 1-(azepan-1-ylsulfonyl)-3,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(azepan-1-ylsulfonyl)-3,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 120779565 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-(azepan-1-ylsulfonyl)-3,3-dimethylpiperidin-4-amine |
| SMILES | CC1(C)CN(S(=O)(=O)N2CCCCCC2)CCC1N |
| InChI | InChI=1S/C13H27N3O2S/c1-13(2)11-16(10-7-12(13)14)19(17,18)15-8-5-3-4-6-9-15/h12H,3-11,14H2,1-2H3 |
| InChIKey | DOVCORCVSLPTJE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |