C8H18N2O2S — CID 115269791
3,3-dimethyl-1-methylsulfonylpiperidin-4-amine (PubChem CID 115269791) has the molecular formula C8H18N2O2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 3,3-dimethyl-1-methylsulfonylpiperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 115269791 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3,3-dimethyl-1-methylsulfonylpiperidin-4-amine |
| SMILES | CC1(C)CN(S(C)(=O)=O)CCC1N |
| InChI | InChI=1S/C8H18N2O2S/c1-8(2)6-10(13(3,11)12)5-4-7(8)9/h7H,4-6,9H2,1-3H3 |
| InChIKey | XJBVQTLZTVTTHH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |