C8H16BrNO2S — CID 130533745
4-bromo-3,3-dimethyl-1-methylsulfonylpiperidine (PubChem CID 130533745) has the molecular formula C8H16BrNO2S and a molecular weight of 270.19 g/mol. Its IUPAC name is 4-bromo-3,3-dimethyl-1-methylsulfonylpiperidine.
| Compound Name | 4-bromo-3,3-dimethyl-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 130533745 |
| Molecular Formula | C8H16BrNO2S |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 4-bromo-3,3-dimethyl-1-methylsulfonylpiperidine |
| SMILES | CC1(C)CN(S(C)(=O)=O)CCC1Br |
| InChI | InChI=1S/C8H16BrNO2S/c1-8(2)6-10(13(3,11)12)5-4-7(8)9/h7H,4-6H2,1-3H3 |
| InChIKey | MJCDJRQWADIZPD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|