C10H23ClN2O2S — CID 120779816
3,3-dimethyl-1-propylsulfonylpiperidin-4-amine;hydrochloride (PubChem CID 120779816) has the molecular formula C10H23ClN2O2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 3,3-dimethyl-1-propylsulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 3,3-dimethyl-1-propylsulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120779816 |
| Molecular Formula | C10H23ClN2O2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3,3-dimethyl-1-propylsulfonylpiperidin-4-amine;hydrochloride |
| SMILES | CCCS(=O)(=O)N1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C10H22N2O2S.ClH/c1-4-7-15(13,14)12-6-5-9(11)10(2,3)8-12;/h9H,4-8,11H2,1-3H3;1H |
| InChIKey | XTSLOBRIGSDGAF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |