C12H27ClN2O2S — CID 120725770
2,3-dimethyl-1-(2-methylpentylsulfonyl)piperazine;hydrochloride (PubChem CID 120725770) has the molecular formula C12H27ClN2O2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 2,3-dimethyl-1-(2-methylpentylsulfonyl)piperazine;hydrochloride.
| Compound Name | 2,3-dimethyl-1-(2-methylpentylsulfonyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120725770 |
| Molecular Formula | C12H27ClN2O2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2,3-dimethyl-1-(2-methylpentylsulfonyl)piperazine;hydrochloride |
| SMILES | CCCC(C)CS(=O)(=O)N1CCNC(C)C1C.Cl |
| InChI | InChI=1S/C12H26N2O2S.ClH/c1-5-6-10(2)9-17(15,16)14-8-7-13-11(3)12(14)4;/h10-13H,5-9H2,1-4H3;1H |
| InChIKey | JXTMXJADKCRRCK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |