C10H20N2O5S — CID 79410684
(3S,4R)-1-(2,6-dimethylmorpholin-4-yl)sulfonylpyrrolidine-3,4-diol (PubChem CID 79410684) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is (3S,4R)-1-(2,6-dimethylmorpholin-4-yl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(2,6-dimethylmorpholin-4-yl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410684 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3S,4R)-1-(2,6-dimethylmorpholin-4-yl)sulfonylpyrrolidine-3,4-diol |
| SMILES | CC1CN(S(=O)(=O)N2C[C@@H](O)[C@@H](O)C2)CC(C)O1 |
| InChI | InChI=1S/C10H20N2O5S/c1-7-3-11(4-8(2)17-7)18(15,16)12-5-9(13)10(14)6-12/h7-10,13-14H,3-6H2,1-2H3/t7?,8?,9-,10+ |
| InChIKey | NGTAQQDOUWHMPF-OXYCZDQYSA-N |
| XLogP | -1.62 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |