C7H12Br3NO3S — CID 21445275
2,6-dimethyl-4-(tribromomethylsulfonyl)morpholine (PubChem CID 21445275) has the molecular formula C7H12Br3NO3S and a molecular weight of 429.96 g/mol. Its IUPAC name is 2,6-dimethyl-4-(tribromomethylsulfonyl)morpholine.
| Compound Name | 2,6-dimethyl-4-(tribromomethylsulfonyl)morpholine |
|---|---|
| PubChem CID | 21445275 |
| Molecular Formula | C7H12Br3NO3S |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 426.81 |
| IUPAC Name | 2,6-dimethyl-4-(tribromomethylsulfonyl)morpholine |
| SMILES | CC1CN(S(=O)(=O)C(Br)(Br)Br)CC(C)O1 |
| InChI | InChI=1S/C7H12Br3NO3S/c1-5-3-11(4-6(2)14-5)15(12,13)7(8,9)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | LZTOXPUHQHWYJD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|