C7H16N2O3S — CID 43242358
N,2,6-trimethylmorpholine-4-sulfonamide (PubChem CID 43242358) has the molecular formula C7H16N2O3S and a molecular weight of 208.28 g/mol. Its IUPAC name is N,2,6-trimethylmorpholine-4-sulfonamide.
| Compound Name | N,2,6-trimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 43242358 |
| Molecular Formula | C7H16N2O3S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | N,2,6-trimethylmorpholine-4-sulfonamide |
| SMILES | CNS(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C7H16N2O3S/c1-6-4-9(5-7(2)12-6)13(10,11)8-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | BGWNRQIJFQMRHK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |