C10H22N2O3S — CID 42936366
N-butan-2-yl-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 42936366) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is N-butan-2-yl-2,6-dimethylmorpholine-4-sulfonamide.
| Compound Name | N-butan-2-yl-2,6-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 42936366 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N-butan-2-yl-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-5-8(2)11-16(13,14)12-6-9(3)15-10(4)7-12/h8-11H,5-7H2,1-4H3 |
| InChIKey | LJYZKKVACLBWJO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |