C10H22N2O4S — CID 43501588
N-(1-hydroxybutan-2-yl)-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 43501588) has the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)-2,6-dimethylmorpholine-4-sulfonamide.
| Compound Name | N-(1-hydroxybutan-2-yl)-2,6-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 43501588 |
| Molecular Formula | C10H22N2O4S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | CCC(CO)NS(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C10H22N2O4S/c1-4-10(7-13)11-17(14,15)12-5-8(2)16-9(3)6-12/h8-11,13H,4-7H2,1-3H3 |
| InChIKey | WIFALUDWUNARBY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |