C9H20N2O3S — CID 165470689
(2R,6S)-2,6-dimethyl-N-propan-2-ylmorpholine-4-sulfonamide (PubChem CID 165470689) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-N-propan-2-ylmorpholine-4-sulfonamide.
| Compound Name | (2R,6S)-2,6-dimethyl-N-propan-2-ylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 165470689 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-N-propan-2-ylmorpholine-4-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C9H20N2O3S/c1-7(2)10-15(12,13)11-5-8(3)14-9(4)6-11/h7-10H,5-6H2,1-4H3/t8-,9+ |
| InChIKey | KTNDBCVIIYVBLF-DTORHVGOSA-N |
| XLogP | 0.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |