C11H20N4O3S — CID 103854198
2,6-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]morpholine-4-sulfonamide (PubChem CID 103854198) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2,6-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]morpholine-4-sulfonamide.
| Compound Name | 2,6-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 103854198 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2,6-dimethyl-N-[1-(1H-pyrazol-4-yl)ethyl]morpholine-4-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)NC(C)c2cn[nH]c2)CC(C)O1 |
| InChI | InChI=1S/C11H20N4O3S/c1-8-6-15(7-9(2)18-8)19(16,17)14-10(3)11-4-12-13-5-11/h4-5,8-10,14H,6-7H2,1-3H3,(H,12,13) |
| InChIKey | SUTFJLPYINQJPJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |