C6H10ClN3O2S — CID 106216702
1-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide (PubChem CID 106216702) has the molecular formula C6H10ClN3O2S and a molecular weight of 223.69 g/mol. Its IUPAC name is 1-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 106216702 |
| Molecular Formula | C6H10ClN3O2S |
| Molecular Weight | 223.69 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 1-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide |
| SMILES | CC(NS(=O)(=O)CCl)c1cn[nH]c1 |
| InChI | InChI=1S/C6H10ClN3O2S/c1-5(6-2-8-9-3-6)10-13(11,12)4-7/h2-3,5,10H,4H2,1H3,(H,8,9) |
| InChIKey | PWWWEBPPMGZBJJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.69 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|