C10H20N4O2S — CID 113339062
4-[1-[[butyl(methyl)sulfamoyl]amino]ethyl]-1H-pyrazole (PubChem CID 113339062) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-[1-[[butyl(methyl)sulfamoyl]amino]ethyl]-1H-pyrazole.
| Compound Name | 4-[1-[[butyl(methyl)sulfamoyl]amino]ethyl]-1H-pyrazole |
|---|---|
| PubChem CID | 113339062 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-[1-[[butyl(methyl)sulfamoyl]amino]ethyl]-1H-pyrazole |
| SMILES | CCCCN(C)S(=O)(=O)NC(C)c1cn[nH]c1 |
| InChI | InChI=1S/C10H20N4O2S/c1-4-5-6-14(3)17(15,16)13-9(2)10-7-11-12-8-10/h7-9,13H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | WLVJVFKAXSYRHA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |