C12H14N4O4S — CID 104624356
1-(2-nitrophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide (PubChem CID 104624356) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(2-nitrophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 104624356 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 1-(2-nitrophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]methanesulfonamide |
| SMILES | CC(NS(=O)(=O)Cc1ccccc1[N+](=O)[O-])c1cn[nH]c1 |
| InChI | InChI=1S/C12H14N4O4S/c1-9(11-6-13-14-7-11)15-21(19,20)8-10-4-2-3-5-12(10)16(17)18/h2-7,9,15H,8H2,1H3,(H,13,14) |
| InChIKey | YRORFSRBHMJWTC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|