C13H18N4O2S2 — CID 106208337
2-(2-aminophenyl)sulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]ethanesulfonamide (PubChem CID 106208337) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-(2-aminophenyl)sulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 106208337 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(2-aminophenyl)sulfanyl-N-[1-(1H-pyrazol-4-yl)ethyl]ethanesulfonamide |
| SMILES | CC(NS(=O)(=O)CCSc1ccccc1N)c1cn[nH]c1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-10(11-8-15-16-9-11)17-21(18,19)7-6-20-13-5-3-2-4-12(13)14/h2-5,8-10,17H,6-7,14H2,1H3,(H,15,16) |
| InChIKey | LCYYFLJMYYHJTC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|