C21H21N3O4S — CID 59537384
N-(2-amino-1,2-diphenylethyl)-1-(2-nitrophenyl)methanesulfonamide (PubChem CID 59537384) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-1-(2-nitrophenyl)methanesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-1-(2-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59537384 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-1-(2-nitrophenyl)methanesulfonamide |
| SMILES | NC(c1ccccc1)C(NS(=O)(=O)Cc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C21H21N3O4S/c22-20(16-9-3-1-4-10-16)21(17-11-5-2-6-12-17)23-29(27,28)15-18-13-7-8-14-19(18)24(25)26/h1-14,20-21,23H,15,22H2 |
| InChIKey | ZICDVQIXAFLKSE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|